Etoricoxib-d3 structure
|
Common Name | Etoricoxib-d3 | ||
|---|---|---|---|---|
| CAS Number | 850896-71-8 | Molecular Weight | 358.84200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Etoricoxib-d3Etoricoxib-d3 is the deuterium labeled Etoricoxib[1]. Etoricoxib (MK-0663) is a non steroidal anti-inflammatory agent, acting as a selective and orally active COX-2 inhibitor, with IC50s of 1.1 μM and 116 μM for COX-2 and COX-1 in human whole blood[2][3][4]. |
| Name | 5-chloro-2-(6-methylpyridin-3-yl)-3-[4-(trideuteriomethylsulfonyl)phenyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Description | Etoricoxib-d3 is the deuterium labeled Etoricoxib[1]. Etoricoxib (MK-0663) is a non steroidal anti-inflammatory agent, acting as a selective and orally active COX-2 inhibitor, with IC50s of 1.1 μM and 116 μM for COX-2 and COX-1 in human whole blood[2][3][4]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C18H15ClN2O2S |
|---|---|
| Molecular Weight | 358.84200 |
| Exact Mass | 358.05400 |
| PSA | 68.30000 |
| LogP | 5.25670 |
| InChIKey | MNJVRJDLRVPLFE-BMSJAHLVSA-N |
| SMILES | Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 |
| Etoxib-d3 |
| Etocox-d3 |
| Kingcox-d3 |
| Etropain-d3 |
| Etobrix-d3 |
| Torcoxia-d3 |
| Arcoxia-d3 |
| Tauxib-d3 |
| Etoricoxib-d3 |
| Algix-d3 |