bis(2-ethoxyphenyl) carbonate structure
|
Common Name | bis(2-ethoxyphenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 85068-49-1 | Molecular Weight | 302.32200 | |
| Density | 1.162g/cm3 | Boiling Point | 417.9ºC at 760mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | bis(2-ethoxyphenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 417.9ºC at 760mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32200 |
| Flash Point | 183.6ºC |
| Exact Mass | 302.11500 |
| PSA | 53.99000 |
| LogP | 4.06180 |
| Index of Refraction | 1.542 |
| InChIKey | LTAICIIOZBYBTN-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1OC(=O)Oc1ccccc1OCC |
| HS Code | 2920909090 |
|---|
|
~%
bis(2-ethoxyphe... CAS#:85068-49-1 |
| Literature: Chem. Fabr. v. Heyden Patent: DE72806 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 854 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Kohlensaeure-bis-(2-aethoxy-phenylester) |
| Phenol,2-ethoxy-,carbonate (2:1) (9CI) |
| EINECS 285-309-0 |
| Guaetholcarbonat |
| carbonic acid bis-(2-ethoxy-phenyl ester) |