Methyl 4-amino-5-nitro-2-pyridinecarboxylate
Modify Date: 2025-09-10 10:29:48
Methyl 4-amino-5-nitro-2-pyridinecarboxylate structure
|
Common Name | Methyl 4-amino-5-nitro-2-pyridinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 850544-21-7 | Molecular Weight | 197.148 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 434.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5±28.7 °C | |
| Name | methyl 4-amino-5-nitropyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.4±45.0 °C at 760 mmHg |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.148 |
| Flash Point | 216.5±28.7 °C |
| Exact Mass | 197.043655 |
| PSA | 111.03000 |
| LogP | 1.01 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | UNPOGSAFUSHRDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)c([N+](=O)[O-])cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 4-amino-5-nitropicolinate |
| Methyl 4-amino-5-nitro-2-pyridinecarboxylate |
| Methyl 4-amino-5-nitropyridine-2-carboxylate |
| 2-Pyridinecarboxylic acid, 4-amino-5-nitro-, methyl ester |