2-Bromo-1-(3,4-dichlorophenyl)butan-1-one structure
|
Common Name | 2-Bromo-1-(3,4-dichlorophenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 850352-47-5 | Molecular Weight | 295.98800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Butanone, 2-bromo-1-(3,4-dichlorophenyl) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9BrCl2O |
|---|---|
| Molecular Weight | 295.98800 |
| Exact Mass | 293.92100 |
| PSA | 17.07000 |
| LogP | 4.34960 |
| InChIKey | KZRPLFKVXPXPJR-UHFFFAOYSA-N |
| SMILES | CCC(Br)C(=O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Bromo-1-(3,4-dichlorophenyl)butan-1-one |