(3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride structure
|
Common Name | (3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 850252-34-5 | Molecular Weight | 222.712 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-1-methyl-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H19ClN2O2 |
|---|---|
| Molecular Weight | 222.712 |
| Exact Mass | 222.113510 |
| LogP | 12.86140 |
| InChIKey | LMSDLVWKLIICSU-JPPWUZRISA-N |
| SMILES | CCCC(N)C(O)C(=O)NC1CC1.Cl |
| HS Code | 2924299090 |
|---|
|
~%
(3S)-3-Amino-N-... CAS#:850252-34-5 |
| Literature: WO2005/58821 A1, ; Page/Page column 63 ; WO 2005/058821 A1 |
|
~%
(3S)-3-Amino-N-... CAS#:850252-34-5 |
| Literature: ACS Medicinal Chemistry Letters, , vol. 1, # 2 p. 64 - 69 |
|
~%
(3S)-3-Amino-N-... CAS#:850252-34-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 19, # 8 p. 2295 - 2298 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-amino-2-methyl-i-propanol |
| 2-amino-3-hydroxybutane |
| 2-AMINO-3-BUTANOL |
| 2-butanol,3-amino |
| Hexanamide, 3-amino-N-cyclopropyl-2-hydroxy-, (3S)-, hydrochloride (1:1) |
| 3-amino-2-butanol |
| amino-sec.-butanol |
| methyl-2-amino-1-propanol |
| (3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride (1:1) |
| 3-Amino-butan-2-ol |