4-(4-Fluorophenyl)-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-ol structure
|
Common Name | 4-(4-Fluorophenyl)-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 85010-46-4 | Molecular Weight | 257.26300 | |
| Density | 1.3g/cm3 | Boiling Point | 400.6ºC at 760 mmHg | |
| Molecular Formula | C14H12FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
| Name | 4-(4-fluorophenyl)-3-methyl-1,2,3-benzotriazin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760 mmHg |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.26300 |
| Flash Point | 196.1ºC |
| Exact Mass | 257.09600 |
| PSA | 48.19000 |
| LogP | 1.77230 |
| Index of Refraction | 1.633 |
| InChIKey | QKEIEQJDNYDEOT-UHFFFAOYSA-N |
| SMILES | CN1N=Nc2ccccc2C1(O)c1ccc(F)cc1 |
|
~%
4-(4-Fluorophen... CAS#:85010-46-4 |
| Literature: Faye, Patricia L.; Vaughan, Keith; Hooper, Donald L. Canadian Journal of Chemistry, 1983 , vol. 61, p. 179 - 183 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(4-Fluorophenyl)-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-ol |