4H-Indol-4-one,1,5,6,7-tetrahydro-1,3-dimethyl-2-(4-morpholinylcarbonyl)-
Modify Date: 2025-08-25 09:25:56
4H-Indol-4-one,1,5,6,7-tetrahydro-1,3-dimethyl-2-(4-morpholinylcarbonyl)- structure
|
Common Name | 4H-Indol-4-one,1,5,6,7-tetrahydro-1,3-dimethyl-2-(4-morpholinylcarbonyl)- | ||
|---|---|---|---|---|
| CAS Number | 84990-23-8 | Molecular Weight | 276.33100 | |
| Density | 1.31g/cm3 | Boiling Point | 516.6ºC at 760mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | 1,3-dimethyl-2-(morpholine-4-carbonyl)-6,7-dihydro-5H-indol-4-one |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 516.6ºC at 760mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33100 |
| Flash Point | 266.2ºC |
| Exact Mass | 276.14700 |
| PSA | 51.54000 |
| LogP | 1.26280 |
| Index of Refraction | 1.631 |
| InChIKey | RANXZJNGHYJNFO-UHFFFAOYSA-N |
| SMILES | Cc1c2c(n(C)c1C(=O)N1CCOCC1)CCCC2=O |
|
~50%
4H-Indol-4-one,... CAS#:84990-23-8 |
| Literature: Singh, Rajeshwar; Bhagavateeswaran, H.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 9 p. 853 - 856 |
|
~%
4H-Indol-4-one,... CAS#:84990-23-8 |
| Literature: Singh, Rajeshwar; Bhagavateeswaran, H.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 9 p. 853 - 856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |