ethyl 6,8-dimethyl-4,5-dihydropyrrolo[2,3-g][1,2]benzoxazole-7-carboxylate structure
|
Common Name | ethyl 6,8-dimethyl-4,5-dihydropyrrolo[2,3-g][1,2]benzoxazole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 84990-14-7 | Molecular Weight | 260.28800 | |
| Density | 1.33g/cm3 | Boiling Point | 442ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.1ºC | |
| Name | ethyl 6,8-dimethyl-4,5-dihydropyrrolo[2,3-g][1,2]benzoxazole-7-carboxylate |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 442ºC at 760 mmHg |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.28800 |
| Flash Point | 221.1ºC |
| Exact Mass | 260.11600 |
| PSA | 57.26000 |
| LogP | 2.26380 |
| Index of Refraction | 1.628 |
| InChIKey | SLSPKFDNCUVWIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c2c(n1C)CCc1cnoc1-2 |
|
~41%
ethyl 6,8-dimet... CAS#:84990-14-7 |
| Literature: Singh, Rajeshwar; Bhagavateeswaran, H.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 9 p. 853 - 856 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |