5-oxo-L-proline, compound with DL-alanine (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with DL-alanine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84962-38-9 | Molecular Weight | 218.20700 | |
| Density | N/A | Boiling Point | 566.5ºC at 760mmHg | |
| Molecular Formula | C8H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Oxo-L-proline-L-alanine (1:1) |
|---|
| Boiling Point | 566.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.20700 |
| Exact Mass | 218.09000 |
| PSA | 133.21000 |
| InChIKey | BCTQVLPHKMWFQL-DFWYDOINSA-N |
| SMILES | CC(N)C(=O)O.O=C1CCC(C(=O)O)N1 |