Dipyridamole and prednisolone combination
Modify Date: 2025-10-23 16:49:32
Dipyridamole and prednisolone combination structure
|
Common Name | Dipyridamole and prednisolone combination | ||
|---|---|---|---|---|
| CAS Number | 849333-19-3 | Molecular Weight | 865.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H68N8O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dipyridamole and prednisolone combination |
|---|
| Molecular Formula | C45H68N8O9 |
|---|---|
| Molecular Weight | 865.1 |
CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO.OCCN(CCO)c1nc(N2CCCCC2)c2nc(N(CCO)CCO)nc(N3CCCCC3)c2n1