2-[4-(4-aminophenyl)sulfanylphenyl]imino-1-thiophen-2-ylethanone structure
|
Common Name | 2-[4-(4-aminophenyl)sulfanylphenyl]imino-1-thiophen-2-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 84933-42-6 | Molecular Weight | 338.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(4-aminophenyl)sulfanylphenyl]imino-1-thiophen-2-ylethanone |
|---|
| Molecular Formula | C18H14N2OS2 |
|---|---|
| Molecular Weight | 338.44700 |
| Exact Mass | 338.05500 |
| PSA | 108.99000 |
| LogP | 5.64790 |
| InChIKey | PBLOFZNNICSDHD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Sc2ccc(N=CC(=O)c3cccs3)cc2)cc1 |
|
~%
2-[4-(4-aminoph... CAS#:84933-42-6 |
| Literature: Verma, H. S.; Pal, Anang; Saxena, R. C.; Vats, J. L. Journal of the Indian Chemical Society, 1982 , vol. 59, # 10 p. 1184 - 1186 |