1-Boc-2-(2'-chloroacetyl)-pyrrolidine structure
|
Common Name | 1-Boc-2-(2'-chloroacetyl)-pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 848819-60-3 | Molecular Weight | 247.719 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 330.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4±25.1 °C | |
| Name | tert-butyl 2-(2-chloroacetyl)pyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.0±32.0 °C at 760 mmHg |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.719 |
| Flash Point | 153.4±25.1 °C |
| Exact Mass | 247.097519 |
| PSA | 46.61000 |
| LogP | 1.41 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | FXJFCSOQVPPIHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)CCl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-2-(2-chloroacetyl)pyrrolidine |
| 2-Methyl-2-propanyl 2-(chloroacetyl)-1-pyrrolidinecarboxylate |
| (R)-TERT-BUTYL 2-(2-CHLOROACETYL)PYRROLIDINE-1-CARBOXYLATE |
| 1-Pyrrolidinecarboxylic acid, 2-(2-chloroacetyl)-, 1,1-dimethylethyl ester |