ITX-5061 structure
|
Common Name | ITX-5061 | ||
|---|---|---|---|---|
| CAS Number | 848144-15-0 | Molecular Weight | 583.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H37N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ITX-5061ITX-5061 is a scavenger receptor B1 antagonist that promotes high-density lipoprotein (HDL) levels. |
| Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H37N3O7S |
|---|---|
| Molecular Weight | 583.69600 |
| Exact Mass | 583.23500 |
| PSA | 135.14000 |
| LogP | 5.79100 |
| InChIKey | UUROSJLZNDSXRF-UHFFFAOYSA-N |
| SMILES | COc1c(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c3ccccc23)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| UNII-RDD1D7O9YX |
| ITX 5061 free base |
| ITX-5061 |