4-(4-chlorophenyl)piperidine-2,6-dione structure
|
Common Name | 4-(4-chlorophenyl)piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 84803-46-3 | Molecular Weight | 223.65600 | |
| Density | 1.303g/cm3 | Boiling Point | 418.7ºC at 760 mmHg | |
| Molecular Formula | C11H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | 4-(4-chlorophenyl)piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760 mmHg |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.65600 |
| Flash Point | 207ºC |
| Exact Mass | 223.04000 |
| PSA | 46.17000 |
| LogP | 2.18900 |
| Index of Refraction | 1.566 |
| InChIKey | KOZWYRYCGOBBKD-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(Cl)cc2)CC(=O)N1 |
| HS Code | 2925190090 |
|---|
|
~81%
4-(4-chlorophen... CAS#:84803-46-3 |
| Literature: Romeo, Giuseppe; Materia, Luisa; Modica, Maria N.; Pittal, Valeria; Salerno, Loredana; Siracusa, Maria A.; Manetti, Fabrizio; Botta, Maurizio; Minneman, Kenneth P. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 7 p. 2676 - 2690 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00239025 |