CHEMBRDG-BB 9046110
Modify Date: 2025-10-10 20:11:32
CHEMBRDG-BB 9046110 structure
|
Common Name | CHEMBRDG-BB 9046110 | ||
|---|---|---|---|---|
| CAS Number | 847588-85-6 | Molecular Weight | 233.26300 | |
| Density | 1.301g/cm3 | Boiling Point | 497.9ºC at 760 mmHg | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | 4-(2,3-dihydro-1H-inden-5-ylamino)-4-oxobutanoic acid |
|---|
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760 mmHg |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26300 |
| Flash Point | 254.9ºC |
| Exact Mass | 233.10500 |
| PSA | 66.40000 |
| LogP | 2.05160 |
| Index of Refraction | 1.626 |
| InChIKey | XHCKXCXPITWYAM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc2c(c1)CCC2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |