2,5-dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-[(4-sulphophenyl)azo]-1H-pyrazol-1-yl]benzenesulphonic acid, compound with N,N'-di-o-tolylguanidine (1:2) structure
|
Common Name | 2,5-dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-[(4-sulphophenyl)azo]-1H-pyrazol-1-yl]benzenesulphonic acid, compound with N,N'-di-o-tolylguanidine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 84753-00-4 | Molecular Weight | 985.95600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H46Cl2N10O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(2-methylphenyl)guanidine,2,5-dichloro-4-[3-methyl-5-oxo-4-[(4-sulfophenyl)diazenyl]-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C46H46Cl2N10O7S2 |
|---|---|
| Molecular Weight | 985.95600 |
| Exact Mass | 984.23700 |
| PSA | 278.71000 |
| LogP | 13.03980 |
| InChIKey | QILDUVCJEUKTRT-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)C1N=Nc1ccc(S(=O)(=O)O)cc1.Cc1ccccc1N=C(N)Nc1ccccc1C.Cc1ccccc1N=C(N)Nc1ccccc1C |
| einecs 283-846-5 |