p-[[p-[[p-(diethylamino)phenyl]azo]phenyl]azo]benzenesulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | p-[[p-[[p-(diethylamino)phenyl]azo]phenyl]azo]benzenesulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84732-30-9 | Molecular Weight | 586.70300 | |
| Density | N/A | Boiling Point | 817.4ºC at 760 mmHg | |
| Molecular Formula | C28H38N6O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 448.1ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,4-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|
| Boiling Point | 817.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C28H38N6O6S |
| Molecular Weight | 586.70300 |
| Flash Point | 448.1ºC |
| Exact Mass | 586.25700 |
| PSA | 179.36000 |
| LogP | 5.95640 |
| InChIKey | DQARKKMBYDXXFL-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2ccc(N=Nc3ccc(S(=O)(=O)O)cc3)cc2)cc1.OCCN(CCO)CCO |