3-ethenylsulfonyl-5-methoxy-2-methyl-1H-indole structure
|
Common Name | 3-ethenylsulfonyl-5-methoxy-2-methyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 847255-84-9 | Molecular Weight | 251.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethenylsulfonyl-5-methoxy-2-methyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO3S |
|---|---|
| Molecular Weight | 251.30200 |
| Exact Mass | 251.06200 |
| PSA | 67.54000 |
| LogP | 3.48290 |
| InChIKey | CPKCMSXKPGMDNA-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)c1c(C)[nH]c2ccc(OC)cc12 |
|
~89%
3-ethenylsulfon... CAS#:847255-84-9 |
| Literature: Kumar, Ashok; Archana; Sharma, Shalabh; Malik, Nidhi; Sharma, Preeti; Kaushik, Kavita; Saxena, Kuldeep Kumar; Srivastava, Virendra Kishore; Verma; Sharma, Himansahu; Gupta; Gupta, Vipul; Agarwal Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 7 p. 1532 - 1536 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-3-vinylsulphonyl-5-methoxyindole |