1,4:5,8-Dimethanotriphenylene,10-bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro-11-nitro-
Modify Date: 2025-08-25 12:15:01
1,4:5,8-Dimethanotriphenylene,10-bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro-11-nitro- structure
|
Common Name | 1,4:5,8-Dimethanotriphenylene,10-bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro-11-nitro- | ||
|---|---|---|---|---|
| CAS Number | 84605-00-5 | Molecular Weight | 797.60700 | |
| Density | 2.12g/cm3 | Boiling Point | 641ºC at 760 mmHg | |
| Molecular Formula | C20H6BrCl12NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.5ºC | |
| Name | 10-bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro-11-nitro-1,4-5,8-dimethanotriphenylene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.12g/cm3 |
|---|---|
| Boiling Point | 641ºC at 760 mmHg |
| Molecular Formula | C20H6BrCl12NO2 |
| Molecular Weight | 797.60700 |
| Flash Point | 341.5ºC |
| Exact Mass | 790.58400 |
| PSA | 45.82000 |
| LogP | 10.98470 |
| Index of Refraction | 1.744 |
| InChIKey | PQCIWCLZNVPWIH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c(cc1Br)C1C(C3C2C2(Cl)C(Cl)=C(Cl)C3(Cl)C2(Cl)Cl)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
|
~%
1,4:5,8-Dimetha... CAS#:84605-00-5 |
| Literature: Fenyes,J.G.E. Journal of Organic Chemistry, 1962 , vol. 27, p. 2614 - 2618 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:67116-33-0
CAS#:54245-33-9| 10-Bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-11-nitro-1,4,4a,4b,5,8,8a,12b-octahydro-1,4:5,8-dimethanotriphenylene |
| 3-Brom-2-nitro-naphthalin-Di-hexachlor-cyclopentadien-Addukt |
| 10-Bromo-1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro-11-nitro-1,4:5,8-dimethanotriphenylene |