N-(1H-Benzo[d]imidazol-2-yl)-2-chloroacetamide structure
|
Common Name | N-(1H-Benzo[d]imidazol-2-yl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 84587-80-4 | Molecular Weight | 209.63200 | |
| Density | 1.502g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1H-benzimidazol-2-yl)-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.63200 |
| Exact Mass | 209.03600 |
| PSA | 57.78000 |
| LogP | 1.81320 |
| Index of Refraction | 1.73 |
| InChIKey | ZBCXNGGSMCVRHL-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1nc2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~84%
N-(1H-Benzo[d]i... CAS#:84587-80-4 |
| Literature: Mobinikhaledi, Akbar; Kalhor, Mehdi; Hatami, Masoome Heterocyclic Communications, 2010 , vol. 16, # 2-3 p. 165 - 170 |
|
~%
N-(1H-Benzo[d]i... CAS#:84587-80-4 |
| Literature: Graubaum, Heinz; Martin, Dieter; Csunderlik, Carol; Glatt, Hans-Horst; Bacaloglu, Radu; Malurea-Munteanu, Mirela Zeitschrift fuer Chemie (Stuttgart, Germany), 1984 , vol. 24, # 2 p. 57 - 58 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloroacetylamino-benzimidazole |
| chloroacetyl-2-aminobenzimidazole |
| N-1H-BENZIMIDAZOL-2-YL-2-CHLOROACETAMIDE |