Ethyl 4-n-propylbenzoylformate structure
|
Common Name | Ethyl 4-n-propylbenzoylformate | ||
|---|---|---|---|---|
| CAS Number | 845790-55-8 | Molecular Weight | 220.26400 | |
| Density | 1.065g/cm3 | Boiling Point | 320.6ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 141.1ºC | |
| Name | Ethyl 4-n-propylbenzoylformate |
|---|
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 320.6ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 141.1ºC |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 2.38490 |
| Index of Refraction | 1.506 |
| InChIKey | CNRWTXQCEJIFSU-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C(=O)C(=O)OCC)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
Ethyl 4-n-propy... CAS#:845790-55-8 |
| Literature: Kindler; Metzendorf; Dschi-yin-Kwok Chemische Berichte, 1943 , vol. 76, p. 308,313 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |