2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-nitrophenol structure
|
Common Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 84567-86-2 | Molecular Weight | 350.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-nitrophenol |
|---|
| Molecular Formula | C19H18N4O3 |
|---|---|
| Molecular Weight | 350.37100 |
| Exact Mass | 350.13800 |
| PSA | 95.07000 |
| LogP | 3.81600 |
| InChIKey | NOCRPKUXWRQMHY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1 |
|
~%
2-[[bis(pyridin... CAS#:84567-86-2 |
| Literature: Uma, Rajendran; Viswanathan, Rathinam; Palaniandavar, Mallayan; Lakshminarayanan, M. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1994 , # 8 p. 1219 - 1226 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |