3-BROMO-4'-1-BUTYLBENZOPHENONE
Modify Date: 2025-10-01 13:12:08
3-BROMO-4'-1-BUTYLBENZOPHENONE structure
|
Common Name | 3-BROMO-4'-1-BUTYLBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 844879-33-0 | Molecular Weight | 317.22000 | |
| Density | 1.271g/cm3 | Boiling Point | 412.6ºC at 760 mmHg | |
| Molecular Formula | C17H17BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 37.8ºC | |
| Name | (3-bromophenyl)-(4-butylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 412.6ºC at 760 mmHg |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.22000 |
| Flash Point | 37.8ºC |
| Exact Mass | 316.04600 |
| PSA | 17.07000 |
| LogP | 5.02270 |
| Index of Refraction | 1.575 |
| InChIKey | WNMIRAAPSOZXCV-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)c2cccc(Br)c2)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-bromo-4'-1-butylbenzophenone |
| 3-Bromo-4'-n-butylbenzophenone |