1-Naphthalenesulfonicacid, 4-methoxy-, sodium salt (1:1) structure
|
Common Name | 1-Naphthalenesulfonicacid, 4-methoxy-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84473-60-9 | Molecular Weight | 261.24900 | |
| Density | 1.398g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10NaO4S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,4-methoxynaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398g/cm3 |
|---|---|
| Molecular Formula | C11H10NaO4S+ |
| Molecular Weight | 261.24900 |
| Exact Mass | 261.02000 |
| PSA | 71.98000 |
| LogP | 3.17590 |
| Index of Refraction | 1.635 |
| InChIKey | NPLRGULPDAYSHW-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)O)c2ccccc12 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methoxy-1-naphthalenesulfonic acid sodium salt |
| sodium 4-methoxynaphthalenesulphonate |