ACETIC ACID, 2-[(9-OXO-9H-THIOXANTHEN-2-YL)OXY]- structure
|
Common Name | ACETIC ACID, 2-[(9-OXO-9H-THIOXANTHEN-2-YL)OXY]- | ||
|---|---|---|---|---|
| CAS Number | 84434-05-9 | Molecular Weight | 286.30300 | |
| Density | 1.451g/cm3 | Boiling Point | 528.9ºC at 760 mmHg | |
| Molecular Formula | C15H10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.7ºC | |
| Name | 2-(9-oxothioxanthen-2-yl)oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 528.9ºC at 760 mmHg |
| Molecular Formula | C15H10O4S |
| Molecular Weight | 286.30300 |
| Flash Point | 273.7ºC |
| Exact Mass | 286.03000 |
| PSA | 91.84000 |
| LogP | 2.87810 |
| Index of Refraction | 1.685 |
| InChIKey | LJUKODJASZSKFL-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc2sc3ccccc3c(=O)c2c1 |
| HS Code | 2932999099 |
|---|
|
~47%
ACETIC ACID, 2-... CAS#:84434-05-9 |
| Literature: Great Lakes (UK) Limited Patent: EP1380580 A1, 2004 ; Location in patent: Page 4 ; |
|
~73%
ACETIC ACID, 2-... CAS#:84434-05-9 |
| Literature: Great Lakes (UK) Limited Patent: EP1380580 A1, 2004 ; Location in patent: Page 4 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[(9-oxo-9H-thioxanthen-2-yl)oxy]-acetic acid |
| 2-carboxymethyloxy-thioxanthone |
| ((9-Oxo-9H-thioxanthen-2-yl)oxy)acetic acid |
| 2-carboxymethoxythioxanthone |
| EINECS 282-803-8 |