4-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]butanoic acid structure
|
Common Name | 4-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 84393-31-7 | Molecular Weight | 365.55000 | |
| Density | 0.963g/cm3 | Boiling Point | 559.5ºC at 760 mmHg | |
| Molecular Formula | C22H39NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.2ºC | |
| Name | 4-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.963g/cm3 |
|---|---|
| Boiling Point | 559.5ºC at 760 mmHg |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.55000 |
| Flash Point | 292.2ºC |
| Exact Mass | 365.29300 |
| PSA | 69.89000 |
| LogP | 6.62120 |
| Index of Refraction | 1.487 |
| InChIKey | YGFYZZQGVSUXJE-HZJYTTRNSA-N |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCCCC(=O)O |
| HS Code | 2924199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Linoleoyl GABA |
| C22H39NO3 |
| GABA-linoleamide |