[3-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone
Modify Date: 2025-08-24 21:04:29
![[3-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone Structure](https://image.chemsrc.com/caspic/166/84369-68-6.png)
[3-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone structure
|
Common Name | [3-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 84369-68-6 | Molecular Weight | 538.80200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|
| Molecular Formula | C38H50O2 |
|---|---|
| Molecular Weight | 538.80200 |
| Exact Mass | 538.38100 |
| PSA | 34.14000 |
| LogP | 10.88900 |
| InChIKey | LGGHVVLTFFRMMV-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)c2cccc(C(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2)c(C(C)C)c1 |
|
~64%
[3-[2,4,6-tri(p... CAS#:84369-68-6 |
| Literature: Ito, Yoshikatsu; Giri, Brij Pal; Nakasuji, Masaaki; Hagiwara, Toshiya; Matsuura, Teruo Journal of the American Chemical Society, 1983 , vol. 105, # 5 p. 1117 - 1122 |
|
~0%
[3-[2,4,6-tri(p... CAS#:84369-68-6 |
| Literature: Ito, Yoshikatsu; Giri, Brij Pal; Nakasuji, Masaaki; Hagiwara, Toshiya; Matsuura, Teruo Journal of the American Chemical Society, 1983 , vol. 105, # 5 p. 1117 - 1122 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |