L-Phenylalanine,Indole-15N
Modify Date: 2025-09-22 17:42:04
L-Phenylalanine,Indole-15N structure
|
Common Name | L-Phenylalanine,Indole-15N | ||
|---|---|---|---|---|
| CAS Number | 84344-22-9 | Molecular Weight | 205.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Phenylalanine,Indole-15NL-Phenylalanine,Indole-15N is the 15N labeled L-Tryptophan[1]. L-Tryptophan (Tryptophan) is an essential amino acid that is the precursor of serotonin, melatonin, and vitamin B3[2]. |
| Name | L-[15Nindole]tryptophan |
|---|---|
| Synonym | More Synonyms |
| Description | L-Phenylalanine,Indole-15N is the 15N labeled L-Tryptophan[1]. L-Tryptophan (Tryptophan) is an essential amino acid that is the precursor of serotonin, melatonin, and vitamin B3[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C11H12N2O2 |
|---|---|
| Molecular Weight | 205.21900 |
| Exact Mass | 205.08700 |
| PSA | 79.11000 |
| LogP | 1.82260 |
| InChIKey | QIVBCDIJIAJPQS-DQOKOWHWSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O |
| (S)-tryptophan-indole-(15)N |
| L-TRYPTOPHAN (INDOLE-15N) |
| L-(15Nindole)tryptophan |
| L-<1'-(15N)>tryptophan |
| <15NεI>-tryptophan |