5-methyl-3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid(SALTDATA: FREE)
Modify Date: 2025-09-15 12:23:46
5-methyl-3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid(SALTDATA: FREE) structure
|
Common Name | 5-methyl-3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 842954-77-2 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 5-methyl-3-phenyl-4H-1,2-oxazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 58.89000 |
| LogP | 1.08990 |
| InChIKey | HHSXXVCKNAZBGR-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)O)CC(c2ccccc2)=NO1 |
| HS Code | 2934999090 |
|---|
|
~95%
5-methyl-3-phen... CAS#:842954-77-2 |
| Literature: LG LIFE SCIENCES LTD. Patent: WO2005/21516 A1, 2005 ; Location in patent: Page/Page column 22-23 ; WO 2005/021516 A1 |
|
~%
5-methyl-3-phen... CAS#:842954-77-2 |
| Literature: WO2006/90234 A1, ; Page/Page column 33-34 ; |
|
~%
5-methyl-3-phen... CAS#:842954-77-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 5 p. 1482 - 1485 |
|
~%
5-methyl-3-phen... CAS#:842954-77-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 5 p. 1482 - 1485 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Methyl-3-phenyl-4,5-dihydro-isoxazole-5-carboxylic acid |
| 5-Methyl-3-phenyl-4,5-dihydro-isoxazol-5-carbonsaeure |
| 5-methyl-3-phenyl-4,5-dihydro-5-isoxazolecarboxylic acid |
| 5-methyl-3-phenyl-4,5-dihydro-isoxazole-4-carboxylic acid |