N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-DL-threonine, compound with piperidine (1:1) structure
|
Common Name | N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-DL-threonine, compound with piperidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84282-14-4 | Molecular Weight | 437.55300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H31N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-hydroxybutanoic acid,piperidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H31N3O5S |
|---|---|
| Molecular Weight | 437.55300 |
| Exact Mass | 437.19800 |
| PSA | 127.35000 |
| LogP | 3.57850 |
| InChIKey | BOLRKZDBAWTVSN-VSLILLSYSA-N |
| SMILES | C1CCNCC1.CC(O)C(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)O |
| einecs 282-660-1 |