N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-DL-serine, compound with piperidine (1:1) structure
|
Common Name | N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-DL-serine, compound with piperidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84282-13-3 | Molecular Weight | 423.52600 | |
| Density | N/A | Boiling Point | 646.6ºC at 760mmHg | |
| Molecular Formula | C20H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.9ºC | |
| Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-hydroxypropanoic acid,piperidine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 646.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.52600 |
| Flash Point | 344.9ºC |
| Exact Mass | 423.18300 |
| PSA | 127.35000 |
| LogP | 3.19000 |
| InChIKey | PMLYLUHIMARDID-UHFFFAOYSA-N |
| SMILES | C1CCNCC1.CN(C)c1cccc2c(S(=O)(=O)NC(CO)C(=O)O)cccc12 |
| einecs 282-659-6 |