N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-L-serine, compound with piperidine (1:1) structure
|
Common Name | N-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-L-serine, compound with piperidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84282-12-2 | Molecular Weight | 423.526 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-{[5-(Dimethylamino)-1-naphthyl]sulfonyl}-L-serine-piperidine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H29N3O5S |
|---|---|
| Molecular Weight | 423.526 |
| Exact Mass | 423.182800 |
| InChIKey | PMLYLUHIMARDID-YDALLXLXSA-N |
| SMILES | C1CCNCC1.CN(C)c1cccc2c(S(=O)(=O)NC(CO)C(=O)O)cccc12 |
| Piperidinium (2S)-2-({[5-(dimethylamino)-1-naphthyl]sulfonyl}amino)-3-hydroxypropanoate |
| EINECS 282-659-6 |
| N-{[5-(Dimethylamino)-1-naphthyl]sulfonyl}-L-serine - piperidine (1:1) |
| L-Serine, N-[[5-(dimethylamino)-1-naphthalenyl]sulfonyl]-, compd. with piperidine (1:1) |
| EINECS 282-658-0 |
| MFCD06809727 |