3-(anilinomethyl)-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione structure
|
Common Name | 3-(anilinomethyl)-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 84249-74-1 | Molecular Weight | 284.33600 | |
| Density | 1.33g/cm3 | Boiling Point | 453.2ºC at 760 mmHg | |
| Molecular Formula | C14H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | 3-(anilinomethyl)-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 453.2ºC at 760 mmHg |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.33600 |
| Flash Point | 227.9ºC |
| Exact Mass | 284.07300 |
| PSA | 87.97000 |
| LogP | 3.41020 |
| Index of Refraction | 1.689 |
| InChIKey | ILZNZLJXRVKFNZ-UHFFFAOYSA-N |
| SMILES | S=c1oc(-c2ccncc2)nn1CNc1ccccc1 |
|
~60%
3-(anilinomethy... CAS#:84249-74-1 |
| Literature: Singh; Saxena; Shankar European Journal of Medicinal Chemistry, 1986 , vol. 21, # 3 p. 267 - 269 |
|
~%
3-(anilinomethy... CAS#:84249-74-1 |
| Literature: Singh; Saxena; Shankar European Journal of Medicinal Chemistry, 1986 , vol. 21, # 3 p. 267 - 269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |