2H-Indol-2-one,1,3-dihydro-3-(2-oxo-2-phenylethyl)- structure
|
Common Name | 2H-Indol-2-one,1,3-dihydro-3-(2-oxo-2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 842-27-3 | Molecular Weight | 251.28000 | |
| Density | 1.207g/cm3 | Boiling Point | 448.4ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 3-phenacyl-1,3-dihydroindol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760 mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 180.1ºC |
| Exact Mass | 251.09500 |
| PSA | 46.17000 |
| LogP | 3.13330 |
| Index of Refraction | 1.604 |
| InChIKey | JOHSNURDMNSIER-UHFFFAOYSA-N |
| SMILES | O=C(CC1C(=O)Nc2ccccc21)c1ccccc1 |
|
~91%
2H-Indol-2-one,... CAS#:842-27-3 |
| Literature: Beccalli, Egle M.; Marchesini, Alessandro; Pilati, Tullio Tetrahedron, 1993 , vol. 49, # 21 p. 4741 - 4758 |
|
~%
2H-Indol-2-one,... CAS#:842-27-3 |
| Literature: Beccalli, Egle M.; Marchesini, Alessandro; Pilati, Tullio Tetrahedron, 1993 , vol. 49, # 21 p. 4741 - 4758 |
|
~%
2H-Indol-2-one,... CAS#:842-27-3 |
| Literature: Lindwall; Maclennan Journal of the American Chemical Society, 1932 , vol. 54, p. 4739,4741 |
|
~%
2H-Indol-2-one,... CAS#:842-27-3 |
| Literature: Lindwall; Maclennan Journal of the American Chemical Society, 1932 , vol. 54, p. 4739,4741 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-Benzoylmethyl-oxindol |
| 3-Phenacyl-2-indolinon |
| F3371-0594 |
| 3-Phenacyl-oxindol |
| 3-phenacyl-indolin-2-one |
| 3-Phenacyl-indolin-2-on |