3-(3-methoxyphenyl)tellanyl-3-phenylprop-2-enoic acid structure
|
Common Name | 3-(3-methoxyphenyl)tellanyl-3-phenylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 84144-25-2 | Molecular Weight | 381.88100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3Te | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-methoxyphenyl)tellanyl-3-phenylprop-2-enoic acid |
|---|
| Molecular Formula | C16H14O3Te |
|---|---|
| Molecular Weight | 381.88100 |
| Exact Mass | 384.00100 |
| PSA | 46.53000 |
| LogP | 2.77600 |
| InChIKey | OWZOFBYWBHUBPO-UHFFFAOYSA-N |
| SMILES | COc1cccc([Te]C(=CC(=O)O)c2ccccc2)c1 |
|
~95%
3-(3-methoxyphe... CAS#:84144-25-2 |
| Literature: Detty,M.R.; Murray,B.J. Journal of the American Chemical Society, 1983 , vol. 105, p. 883 |
|
~%
3-(3-methoxyphe... CAS#:84144-25-2 |
| Literature: Detty,M.R.; Murray,B.J. Journal of the American Chemical Society, 1983 , vol. 105, p. 883 |
|
~%
3-(3-methoxyphe... CAS#:84144-25-2 |
| Literature: Detty,M.R.; Murray,B.J. Journal of the American Chemical Society, 1983 , vol. 105, p. 883 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |