phenacyl 2-(2-phenylethylamino)benzoate
Modify Date: 2025-09-27 18:40:48
phenacyl 2-(2-phenylethylamino)benzoate structure
|
Common Name | phenacyl 2-(2-phenylethylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 84123-52-4 | Molecular Weight | 359.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 2-(2-phenylethylamino)benzoate |
|---|
| Molecular Formula | C23H21NO3 |
|---|---|
| Molecular Weight | 359.41800 |
| Exact Mass | 359.15200 |
| PSA | 55.40000 |
| LogP | 4.45390 |
| InChIKey | PHBJKBIZBXWABO-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccccc1NCCc1ccccc1)c1ccccc1 |
|
~86%
phenacyl 2-(2-p... CAS#:84123-52-4 |
| Literature: Council of Scientific and Industrial Research Patent: US4354033 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |