5-Amino-2-(4-aminophenyl)benzofuran structure
|
Common Name | 5-Amino-2-(4-aminophenyl)benzofuran | ||
|---|---|---|---|---|
| CAS Number | 84102-58-9 | Molecular Weight | 224.25800 | |
| Density | 1.273g/cm3 | Boiling Point | 444.812ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | 198ºC | |
| MSDS | N/A | Flash Point | 222.814ºC | |
| Name | 5-Amino-2-(4-aminophenyl)benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 444.812ºC at 760 mmHg |
| Melting Point | 198ºC |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.25800 |
| Flash Point | 222.814ºC |
| Exact Mass | 224.09500 |
| PSA | 65.18000 |
| LogP | 4.42660 |
| Index of Refraction | 1.718 |
| InChIKey | FKMCNLLISWDXJQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2cc3cc(N)ccc3o2)cc1 |
| HS Code | 2932999099 |
|---|
|
~73%
5-Amino-2-(4-am... CAS#:84102-58-9 |
| Literature: Dann, Otto; Char, Helmut; Griessmeier, Helmut Liebigs Annalen der Chemie, 1982 , # 10 p. 1836 - 1869 |
|
~%
5-Amino-2-(4-am... CAS#:84102-58-9 |
| Literature: SHARP KABUSHIKI KAISHA Patent: EP780363 A1, 1997 ; |
|
~%
5-Amino-2-(4-am... CAS#:84102-58-9 |
| Literature: Dann, Otto; Char, Helmut; Griessmeier, Helmut Liebigs Annalen der Chemie, 1982 , # 10 p. 1836 - 1869 |
|
~%
5-Amino-2-(4-am... CAS#:84102-58-9 |
| Literature: Dann, Otto; Char, Helmut; Griessmeier, Helmut Liebigs Annalen der Chemie, 1982 , # 10 p. 1836 - 1869 |
|
~%
5-Amino-2-(4-am... CAS#:84102-58-9 |
| Literature: Dann, Otto; Char, Helmut; Griessmeier, Helmut Liebigs Annalen der Chemie, 1982 , # 10 p. 1836 - 1869 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-aminophenyl)-1-benzofuran-5-amine |