6-CHLORO-3-(PYRIDIN-4-YL)-2H-CHROMEN-2-ONE structure
|
Common Name | 6-CHLORO-3-(PYRIDIN-4-YL)-2H-CHROMEN-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 840-32-4 | Molecular Weight | 257.67200 | |
| Density | 1.396g/cm3 | Boiling Point | 466.6ºC at 760 mmHg | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | 6-chloro-3-pyridin-4-ylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 466.6ºC at 760 mmHg |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.67200 |
| Flash Point | 236ºC |
| Exact Mass | 257.02400 |
| PSA | 43.10000 |
| LogP | 3.50840 |
| Index of Refraction | 1.648 |
| InChIKey | JRWFNWPQMYOVSQ-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc(Cl)cc2cc1-c1ccncc1 |
| HS Code | 2934999090 |
|---|
|
~%
6-CHLORO-3-(PYR... CAS#:840-32-4 |
| Literature: Moffett,R.B. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 446 - 449 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-3-<4-pyridyl>-cumarin |
| 6-chloro-3-pyridin-4-yl-chromen-2-one |