5,6-diaminonaphthalene-1-sulphonic acid
Modify Date: 2025-08-26 14:14:04
5,6-diaminonaphthalene-1-sulphonic acid structure
|
Common Name | 5,6-diaminonaphthalene-1-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 84-92-4 | Molecular Weight | 238.26300 | |
| Density | 1.579g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-diaminonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.579g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.26300 |
| Exact Mass | 238.04100 |
| PSA | 114.79000 |
| LogP | 3.49410 |
| Index of Refraction | 1.756 |
| InChIKey | AWXNJVXWJMGHMQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(S(=O)(=O)O)cccc2c1N |
| HS Code | 2921590090 |
|---|
|
~%
5,6-diaminonaph... CAS#:84-92-4 |
| Literature: Gattermann; Liebermann Justus Liebigs Annalen der Chemie, 1912 , vol. 393, p. 212 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:938-25-0| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2-diaminonaphthalene-5-sulphonic acid |
| 5,6-Diamino-naphthalene-1-sulfonic acid |
| EINECS 201-574-7 |
| 5,6-Diamino-naphthalin-1-sulfonsaeure |
| Naphthylendiamin-(1.2)-sulfonsaeure-(5) |
| 5,6-diaminonaphthalenesulfonic acid |
| 5,6-Diaminonaphthalene-1-sulphonic acid |