bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate structure
|
Common Name | bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 84-71-9 | Molecular Weight | 396.60400 | |
| Density | 0.959 g/cm3 | Boiling Point | 463.9ºC at 760 mmHg | |
| Molecular Formula | C24H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2ºC | |
| Name | 1,2-Cyclohexanedicarboxylicacid, 1,2-bis(2-ethylhexyl) ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.959 g/cm3 |
|---|---|
| Boiling Point | 463.9ºC at 760 mmHg |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.60400 |
| Flash Point | 217.2ºC |
| Exact Mass | 396.32400 |
| PSA | 52.60000 |
| LogP | 6.31200 |
| Index of Refraction | 1.465 |
| InChIKey | DIMOQAGSNHTROK-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1CCCCC1C(=O)OCC(CC)CCCC |
| HS Code | 2917209090 |
|---|
|
~%
bis(2-ethylhexy... CAS#:84-71-9 |
| Literature: NAN YA PLASTICS CORPORATION Patent: US2008/183004 A1, 2008 ; Location in patent: Page/Page column 3 ; |
|
~%
bis(2-ethylhexy... CAS#:84-71-9 |
| Literature: Zhao, Jie; Xue, Mingwei; Huang, Yuan; Shen, Jianyi Catalysis Communications, 2011 , vol. 16, # 1 p. 30 - 34 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Hexahydrophthalic acid di(2-ethylhexyl) ester |
| 1,2-Cyclohexanedicarboxylic acid,bis(2-ethylhexyl) ester |
| Cyclohexan-1,2-dicarbonsaeure-bis-(2-aethyl-hexylester) |
| Einecs 201-554-8 |
| di(2-ethylhexyl) hexahydrophthalate |
| bis(2-ethylhexyl) cyclohexane-1,2-dicarboxylate |
| Diisooctyl 1,2-cyclohexanedicarboxylate |
| Hexahydrophthalic acid bis(2-ethylhexyl) ester |
| cyclohexane-1,2-dicarboxylic acid di(2-ethylhexyl)ester |
| cyclohexane-1,2-dicarboxylic acid bis-(2-ethyl-hexyl ester) |