viquidil structure
|
Common Name | viquidil | ||
|---|---|---|---|---|
| CAS Number | 84-55-9 | Molecular Weight | 324.41700 | |
| Density | 1.125g/cm3 | Boiling Point | 493.1ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252ºC | |
Use of viquidilViquidil (LM 192) is a cerebral vasodilator agent [1]. |
| Name | viquidil |
|---|---|
| Synonym | More Synonyms |
| Description | Viquidil (LM 192) is a cerebral vasodilator agent [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 493.1ºC at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 252ºC |
| Exact Mass | 324.18400 |
| PSA | 51.22000 |
| LogP | 3.94680 |
| Index of Refraction | 1.601 |
| InChIKey | DKRSEIPLAZTSFD-LSDHHAIUSA-N |
| SMILES | C=CC1CNCCC1CCC(=O)c1ccnc2ccc(OC)cc12 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(6-methoxy-4-quinolyl)-3-[(3R,4R)-3-vinyl-4-piperidyl]propan-1-one |
| [3R,4R]-3-Ethenyl-4-[3-oxo-3-(6-methoxyquinolin-4-yl)propyl]piperidine |
| Chinicine |
| Quinotoxol |
| 1-(6-methoxy-quinolin-4-yl)-3-(3-vinyl-piperidin-4-yl)-propan-1-one |
| (3R,4R)-4-[3-oxo-3-(6-methoxyquinolin-4-yl)propyl]-3-vinylpiperidine |
| Quinotoxine |
| d-quinotoxine |
| 1-(6-Methoxy-4-quinolyl)-3-[(3R,4R)-3-vinyl-4-piperidinyl]-1-propanone |
| 3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-one |