C.I.Vat Blue 35 structure
|
Common Name | C.I.Vat Blue 35 | ||
|---|---|---|---|---|
| CAS Number | 84-40-2 | Molecular Weight | 420.05500 | |
| Density | 1.932g/cm3 | Boiling Point | 492ºC at 760 mmHg | |
| Molecular Formula | C16H8Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.3ºC | |
| Name | (2E)-5-bromo-2-(5-bromo-3-oxo-1H-indol-2-ylidene)-1H-indol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.932g/cm3 |
|---|---|
| Boiling Point | 492ºC at 760 mmHg |
| Molecular Formula | C16H8Br2N2O2 |
| Molecular Weight | 420.05500 |
| Flash Point | 251.3ºC |
| Exact Mass | 417.89500 |
| PSA | 58.20000 |
| LogP | 4.61580 |
| Index of Refraction | 1.739 |
| InChIKey | LRBZENFZSJNJCR-UHFFFAOYSA-N |
| SMILES | O=C1C(c2[nH]c3ccc(Br)cc3c2O)=Nc2ccc(Br)cc21 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5'-dibromoindigo |
| Bromoindigo |