Pyr-1
Modify Date: 2024-02-04 12:05:20
Pyr-1 structure
|
Common Name | Pyr-1 | ||
|---|---|---|---|---|
| CAS Number | 83947-94-8 | Molecular Weight | 382.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pyr-1A novel potent, selective, cell permeable and ATP competitive LIMK inhibitor. |
| Name | 9-(benzoyloxy)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1(2H)-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H18N2O3 |
|---|---|
| Molecular Weight | 382.41100 |
| Exact Mass | 382.13200 |
| PSA | 74.95000 |
| LogP | 4.99860 |
| InChIKey | BPGBAEXPBQHBSV-UHFFFAOYSA-N |
| SMILES | Cc1c2cc[nH]c(=O)c2c(C)c2c1[nH]c1ccc(OC(=O)c3ccccc3)cc12 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:72238-05-2![1-[[3-(Ethylamino)propyl]amino]-5,6,11-trimethyl-6H-pyrido[4,3-b]carbazol-9-ol structure](https://image.chemsrc.com/caspic/103/83948-22-5.png)
CAS#:83948-22-5| 9-benzoyloxy-5,11-dimethyl-2H,6H-pyrido[4,3-b]carbazol-1-one |