Flavidin
Modify Date: 2025-08-20 10:49:09
Flavidin structure
|
Common Name | Flavidin | ||
|---|---|---|---|---|
| CAS Number | 83924-98-5 | Molecular Weight | 240.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FlavidinFlavidin, an aromatic compound, can be isolated from Coelogyne longipe. Flavidin is an antioxidant, and has radical scavenging activity[1][2]. |
| Name | Flavidin |
|---|
| Description | Flavidin, an aromatic compound, can be isolated from Coelogyne longipe. Flavidin is an antioxidant, and has radical scavenging activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.25 |
| Exact Mass | 240.07900 |
| PSA | 49.69000 |
| LogP | 2.75580 |
| InChIKey | QMOLHJKSZMURCV-UHFFFAOYSA-N |
| SMILES | Oc1cc2c3c(c1)COc1cc(O)cc(c1-3)CC2 |
| HS Code | 2906299090 |
|---|
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |