methyl [(4-acetylphenoxy)-ethoxyphosphoryl]formate structure
|
Common Name | methyl [(4-acetylphenoxy)-ethoxyphosphoryl]formate | ||
|---|---|---|---|---|
| CAS Number | 83877-28-5 | Molecular Weight | 286.21800 | |
| Density | 1.252g/cm3 | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C12H15O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | methyl [(4-acetylphenoxy)-ethoxyphosphoryl]formate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760 mmHg |
| Molecular Formula | C12H15O6P |
| Molecular Weight | 286.21800 |
| Flash Point | 197.7ºC |
| Exact Mass | 286.06100 |
| PSA | 88.71000 |
| LogP | 3.26400 |
| Index of Refraction | 1.5 |
| InChIKey | DVZQCIQUBJJODW-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Oc1ccc(C(C)=O)cc1)C(=O)OC |
|
~%
methyl [(4-acet... CAS#:83877-28-5 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethyl p-acetylphenyl methoxycarbonylphosphonate |