2-(benzenesulfonamido)-4-(propylcarbamoyl)butanoic acid
Modify Date: 2025-09-13 16:46:25
2-(benzenesulfonamido)-4-(propylcarbamoyl)butanoic acid structure
|
Common Name | 2-(benzenesulfonamido)-4-(propylcarbamoyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 83870-90-0 | Molecular Weight | 328.38400 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(benzenesulfonamido)-5-oxo-5-(propylamino)pentanoic acid |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.38400 |
| Exact Mass | 328.10900 |
| PSA | 120.95000 |
| LogP | 2.58710 |
| Index of Refraction | 1.549 |
| InChIKey | UVFDEFMRMZKCAA-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)CCC(NS(=O)(=O)c1ccccc1)C(=O)O |
|
~63%
2-(benzenesulfo... CAS#:83870-90-0 |
| Literature: De, A. U.; Pandey, Jiten; Majumdar, Anjali Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 481 - 483 |
|
~%
2-(benzenesulfo... CAS#:83870-90-0 |
| Literature: De, A. U.; Pandey, Jiten; Majumdar, Anjali Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 481 - 483 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |