Pyridine,2-[1-[(1,1-dimethylethyl)dimethylsilyl]ethyl]-(9CI) structure
|
Common Name | Pyridine,2-[1-[(1,1-dimethylethyl)dimethylsilyl]ethyl]-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 83862-20-8 | Molecular Weight | 221.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-{1-[Dimethyl(2-methyl-2-propanyl)silyl]ethyl}pyridine |
|---|
| Molecular Formula | C13H23NSi |
|---|---|
| Molecular Weight | 221.41400 |
| Exact Mass | 221.16000 |
| PSA | 12.89000 |
| LogP | 4.32830 |
| InChIKey | OIDZXNLDQDVFGB-UHFFFAOYSA-N |
| SMILES | CC(c1ccccn1)[Si](C)(C)C(C)(C)C |
| HS Code | 2933399090 |
|---|
|
~%
Pyridine,2-[1-[... CAS#:83862-20-8 |
| Literature: Bac, N. V.; Langlois, Y. Journal of the American Chemical Society, 1982 , vol. 104, # 26 p. 7666 - 7667 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |