methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate
Modify Date: 2025-08-20 16:07:51
![methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate Structure](https://image.chemsrc.com/caspic/258/83846-54-2.png)
methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate structure
|
Common Name | methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 83846-54-2 | Molecular Weight | 180.24400 | |
| Density | 1.032g/cm3 | Boiling Point | 215.6ºC at 760 mmHg | |
| Molecular Formula | C11H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75ºC | |
| Name | methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.032g/cm3 |
|---|---|
| Boiling Point | 215.6ºC at 760 mmHg |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.24400 |
| Flash Point | 75ºC |
| Exact Mass | 180.11500 |
| PSA | 26.30000 |
| LogP | 2.00770 |
| Index of Refraction | 1.487 |
| InChIKey | RHEKEOGQJMGRFN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2C=CC(C2)C1(C)C |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| EINECS 281-030-3 |
| 5-carbomethoxy-6,6-dimethyl-2-norbornene |