4(1H)-Quinazolinone,2-(2,6-dichlorophenyl)-2,3-dihydro-
Modify Date: 2025-09-12 01:44:04
4(1H)-Quinazolinone,2-(2,6-dichlorophenyl)-2,3-dihydro- structure
|
Common Name | 4(1H)-Quinazolinone,2-(2,6-dichlorophenyl)-2,3-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 83800-94-6 | Molecular Weight | 293.14800 | |
| Density | 1.376g/cm3 | Boiling Point | 514.8ºC at 760mmHg | |
| Molecular Formula | C14H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.1ºC | |
| Name | 2-(1-hydroxy-1-methyl-ethyl)-2,3-dihydro-furo[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 514.8ºC at 760mmHg |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.14800 |
| Flash Point | 265.1ºC |
| Exact Mass | 292.01700 |
| PSA | 41.13000 |
| LogP | 4.31430 |
| Index of Refraction | 1.62 |
| InChIKey | XNEJBORZTLAGGQ-UHFFFAOYSA-N |
| SMILES | O=C1NC(c2c(Cl)cccc2Cl)Nc2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~84%
4(1H)-Quinazoli... CAS#:83800-94-6 |
| Literature: Karimi-Jaberi, Zahed; Zarei, Leila South African Journal of Chemistry, 2012 , vol. 65, p. 36 - 38 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nodakenetin |
| 7H-Furo(3,2-g)(1)benzopyran-7-one,2,3-dihydro-2-(1-hydroxy-1-methylethyl)-,(S)-(+) |
| (S)-Marmesin |
| (-)-Marmesin |
| 2,3-dihydro-2-(2,6-dichlorophenyl)quinazolin-4(1H)-one |
| 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-7H-furo[3,2-g][1]benzopyran-7-one |