salicylic acid, compound with piperazine-1-ethylamine
Modify Date: 2025-09-19 18:31:09
salicylic acid, compound with piperazine-1-ethylamine structure
|
Common Name | salicylic acid, compound with piperazine-1-ethylamine | ||
|---|---|---|---|---|
| CAS Number | 83748-21-4 | Molecular Weight | 267.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxybenzoic acid,2-piperazin-1-ylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21N3O3 |
|---|---|
| Molecular Weight | 267.32400 |
| Exact Mass | 267.15800 |
| PSA | 98.82000 |
| LogP | 0.90770 |
| InChIKey | ZCFOCZVKWCWCBT-UHFFFAOYSA-N |
| SMILES | NCCN1CCNCC1.O=C(O)c1ccccc1O |
| EINECS 280-687-3 |
| Salicylic acid,compound with piperazine-1-ethylamine |
| Amino ethyl piperazine,salicylic acid polymer |
| Benzoic acid,2-hydroxy-,polymer with 1-piperazineethanamine |